C29H25Cl2NO8 — CID 108699376
ethyl 3-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108699376) has the molecular formula C29H25Cl2NO8 and a molecular weight of 586.42 g/mol. Its IUPAC name is ethyl 3-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108699376 |
| Molecular Formula | C29H25Cl2NO8 |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 585.10 |
| IUPAC Name | ethyl 3-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3OC)C2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C29H25Cl2NO8/c1-5-40-29(36)16-9-6-10-17(12-16)32-23(15-8-7-11-18(13-15)37-2)21(25(34)28(32)35)24(33)19-14-20(30)27(39-4)22(31)26(19)38-3/h6-14,23,33H,5H2,1-4H3/b24-21+ |
| InChIKey | RWGOXCVUQIMOAM-DARPEHSRSA-N |
| XLogP | 5.82 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|