C29H27Cl2NO7 — CID 108688976
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108688976) has the molecular formula C29H27Cl2NO7 and a molecular weight of 572.44 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108688976 |
| Molecular Formula | C29H27Cl2NO7 |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-methoxyphenyl)-5-(3-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3OC)C(=O)C(=O)N2c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C29H27Cl2NO7/c1-5-13-39-19-8-6-7-16(14-19)24-22(25(33)20-15-21(30)28(38-4)23(31)27(20)37-3)26(34)29(35)32(24)17-9-11-18(36-2)12-10-17/h6-12,14-15,24,33H,5,13H2,1-4H3/b25-22+ |
| InChIKey | MHLAVJQMLZUSCM-YYDJUVGSSA-N |
| XLogP | 6.43 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|