C29H28Cl2N2O6 — CID 108675615
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108675615) has the molecular formula C29H28Cl2N2O6 and a molecular weight of 571.46 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108675615 |
| Molecular Formula | C29H28Cl2N2O6 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-[4-(dimethylamino)phenyl]-5-(3-ethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3OC)C(=O)C(=O)N2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C29H28Cl2N2O6/c1-6-39-19-9-7-8-16(14-19)24-22(25(34)20-15-21(30)28(38-5)23(31)27(20)37-4)26(35)29(36)33(24)18-12-10-17(11-13-18)32(2)3/h7-15,24,34H,6H2,1-5H3/b25-22+ |
| InChIKey | FYOZOKAQMSUJEQ-YYDJUVGSSA-N |
| XLogP | 6.10 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|