C32H33Cl2NO6 — CID 108720494
(4E)-1-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108720494) has the molecular formula C32H33Cl2NO6 and a molecular weight of 598.52 g/mol. Its IUPAC name is (4E)-1-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108720494 |
| Molecular Formula | C32H33Cl2NO6 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | (4E)-1-(4-tert-butylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(C(C)(C)C)cc3)C2c2ccc(OC(C)C)cc2)c(OC)c1Cl |
| InChI | InChI=1S/C32H33Cl2NO6/c1-17(2)41-21-14-8-18(9-15-21)26-24(27(36)22-16-23(33)30(40-7)25(34)29(22)39-6)28(37)31(38)35(26)20-12-10-19(11-13-20)32(3,4)5/h8-17,26,36H,1-7H3/b27-24+ |
| InChIKey | GELZPZAJTVXHJB-SOYKGTTHSA-N |
| XLogP | 7.72 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|