C18H36OSi — CID 10859440
1-[(1S,2R,3S,4S)-2,3-dimethyl-4-tri(propan-2-yl)silylcyclopentyl]ethanone (PubChem CID 10859440) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is 1-[(1S,2R,3S,4S)-2,3-dimethyl-4-tri(propan-2-yl)silylcyclopentyl]ethanone.
| Compound Name | 1-[(1S,2R,3S,4S)-2,3-dimethyl-4-tri(propan-2-yl)silylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 10859440 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-[(1S,2R,3S,4S)-2,3-dimethyl-4-tri(propan-2-yl)silylcyclopentyl]ethanone |
| SMILES | CC(=O)[C@H]1C[C@H]([Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H36OSi/c1-11(2)20(12(3)4,13(5)6)18-10-17(16(9)19)14(7)15(18)8/h11-15,17-18H,10H2,1-9H3/t14-,15-,17-,18-/m0/s1 |
| InChIKey | JLCPYTASALBVCZ-LAQRGFTBSA-N |
| XLogP | 5.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|