C17H28OSi2 — CID 11347277
2,5-bis(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one (PubChem CID 11347277) has the molecular formula C17H28OSi2 and a molecular weight of 304.58 g/mol. Its IUPAC name is 2,5-bis(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one.
| Compound Name | 2,5-bis(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 11347277 |
| Molecular Formula | C17H28OSi2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2,5-bis(3-trimethylsilylprop-2-ynyl)cyclopentan-1-one |
| SMILES | C[Si](C)(C)C#CCC1CCC(CC#C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C17H28OSi2/c1-19(2,3)13-7-9-15-11-12-16(17(15)18)10-8-14-20(4,5)6/h15-16H,9-12H2,1-6H3 |
| InChIKey | AFKYPNXKQPLABO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|