C16H18N2O4 — CID 10859609
methyl (2S)-2-[[5-(hydroxymethyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoate (PubChem CID 10859609) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (2S)-2-[[5-(hydroxymethyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[5-(hydroxymethyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10859609 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (2S)-2-[[5-(hydroxymethyl)-1H-pyrrole-2-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(CO)[nH]1 |
| InChI | InChI=1S/C16H18N2O4/c1-22-16(21)14(9-11-5-3-2-4-6-11)18-15(20)13-8-7-12(10-19)17-13/h2-8,14,17,19H,9-10H2,1H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | LDFVOOHKZWSYKE-AWEZNQCLSA-N |
| XLogP | 1.02 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |