C14H26O7 — CID 10859742
(2R)-2-[(1S,2R)-1,2-bis(2-methoxyethoxymethoxy)but-3-enyl]oxirane (PubChem CID 10859742) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R)-2-[(1S,2R)-1,2-bis(2-methoxyethoxymethoxy)but-3-enyl]oxirane.
| Compound Name | (2R)-2-[(1S,2R)-1,2-bis(2-methoxyethoxymethoxy)but-3-enyl]oxirane |
|---|---|
| PubChem CID | 10859742 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R)-2-[(1S,2R)-1,2-bis(2-methoxyethoxymethoxy)but-3-enyl]oxirane |
| SMILES | C=C[C@@H](OCOCCOC)[C@H](OCOCCOC)[C@H]1CO1 |
| InChI | InChI=1S/C14H26O7/c1-4-12(20-10-17-7-5-15-2)14(13-9-19-13)21-11-18-8-6-16-3/h4,12-14H,1,5-11H2,2-3H3/t12-,13-,14+/m1/s1 |
| InChIKey | RMZAFYFUEMORIJ-MCIONIFRSA-N |
| XLogP | 0.58 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|