C26H20ClNO7 — CID 108598261
(4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 108598261) has the molecular formula C26H20ClNO7 and a molecular weight of 493.90 g/mol. Its IUPAC name is (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108598261 |
| Molecular Formula | C26H20ClNO7 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (4E)-1-(1,3-benzodioxol-5-yl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3ccc4c(c3)OCO4)C2c2ccccc2)c(OC)cc1Cl |
| InChI | InChI=1S/C26H20ClNO7/c1-32-19-12-17(27)20(33-2)11-16(19)24(29)22-23(14-6-4-3-5-7-14)28(26(31)25(22)30)15-8-9-18-21(10-15)35-13-34-18/h3-12,23,29H,13H2,1-2H3/b24-22+ |
| InChIKey | ZGHGMGHTZLROBM-ZNTNEXAZSA-N |
| XLogP | 4.71 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|