C25H20ClNO8 — CID 108606967
(4Z)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108606967) has the molecular formula C25H20ClNO8 and a molecular weight of 497.89 g/mol. Its IUPAC name is (4Z)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108606967 |
| Molecular Formula | C25H20ClNO8 |
| Molecular Weight | 497.89 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (4Z)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(OC)c(/C(O)=C2/C(=O)C(=O)N(c3ccc4c(c3)OCCO4)C2c2ccco2)cc1Cl |
| InChI | InChI=1S/C25H20ClNO8/c1-31-18-12-19(32-2)15(26)11-14(18)23(28)21-22(17-4-3-7-33-17)27(25(30)24(21)29)13-5-6-16-20(10-13)35-9-8-34-16/h3-7,10-12,22,28H,8-9H2,1-2H3/b23-21- |
| InChIKey | IFDSCOMPVRJXMG-LNVKXUELSA-N |
| XLogP | 4.35 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|