C17H26O5 — CID 10859862
1-[(4S,5R)-5-[(1S)-3-ethenyl-1-(methoxymethoxy)penta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (PubChem CID 10859862) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[(4S,5R)-5-[(1S)-3-ethenyl-1-(methoxymethoxy)penta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
| Compound Name | 1-[(4S,5R)-5-[(1S)-3-ethenyl-1-(methoxymethoxy)penta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 10859862 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[(4S,5R)-5-[(1S)-3-ethenyl-1-(methoxymethoxy)penta-2,4-dienyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| SMILES | C=CC(C=C)=C[C@H](OCOC)[C@H]1OC(C)(C)O[C@H]1C(O)C=C |
| InChI | InChI=1S/C17H26O5/c1-7-12(8-2)10-14(20-11-19-6)16-15(13(18)9-3)21-17(4,5)22-16/h7-10,13-16,18H,1-3,11H2,4-6H3/t13?,14-,15-,16+/m0/s1 |
| InChIKey | ZMJHBYXRSBKYRL-PNRVRQOCSA-N |
| XLogP | 2.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|