C7H6F6O5S — CID 10860029
ethyl (Z)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate (PubChem CID 10860029) has the molecular formula C7H6F6O5S and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl (Z)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate.
| Compound Name | ethyl (Z)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate |
|---|---|
| PubChem CID | 10860029 |
| Molecular Formula | C7H6F6O5S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | ethyl (Z)-4,4,4-trifluoro-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| SMILES | CCOC(=O)/C=C(\OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O5S/c1-2-17-5(14)3-4(6(8,9)10)18-19(15,16)7(11,12)13/h3H,2H2,1H3/b4-3- |
| InChIKey | BDUFKYMWNPONCZ-ARJAWSKDSA-N |
| XLogP | 1.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|