C23H24FNO3 — CID 108600973
1-(4-ethylphenyl)-2-(4-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one (PubChem CID 108600973) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(4-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(4-ethylphenyl)-2-(4-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108600973 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(4-fluorophenyl)-4-hydroxy-3-(3-methylbutanoyl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H24FNO3/c1-4-15-5-11-18(12-6-15)25-21(16-7-9-17(24)10-8-16)20(22(27)23(25)28)19(26)13-14(2)3/h5-12,14,21,27H,4,13H2,1-3H3 |
| InChIKey | HTQBSQMUSRMVMW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |