C25H22FNO2 — CID 94073400
(2R)-2-(4-ethylphenyl)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-2H-pyrrol-5-one (PubChem CID 94073400) has the molecular formula C25H22FNO2 and a molecular weight of 387.45 g/mol. Its IUPAC name is (2R)-2-(4-ethylphenyl)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-2H-pyrrol-5-one.
| Compound Name | (2R)-2-(4-ethylphenyl)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94073400 |
| Molecular Formula | C25H22FNO2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | (2R)-2-(4-ethylphenyl)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc([C@@H]2C(c3ccc(C)cc3)=C(O)C(=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H22FNO2/c1-3-17-6-10-19(11-7-17)23-22(18-8-4-16(2)5-9-18)24(28)25(29)27(23)21-14-12-20(26)13-15-21/h4-15,23,28H,3H2,1-2H3/t23-/m1/s1 |
| InChIKey | OEATXZDKCCLOEM-HSZRJFAPSA-N |
| XLogP | 5.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |