C24H20FNO2 — CID 51982027
(2R)-2-(4-fluorophenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one (PubChem CID 51982027) has the molecular formula C24H20FNO2 and a molecular weight of 373.43 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one.
| Compound Name | (2R)-2-(4-fluorophenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 51982027 |
| Molecular Formula | C24H20FNO2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
| SMILES | Cc1ccc(CN2C(=O)C(O)=C(c3ccccc3)[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H20FNO2/c1-16-7-9-17(10-8-16)15-26-22(19-11-13-20(25)14-12-19)21(23(27)24(26)28)18-5-3-2-4-6-18/h2-14,22,27H,15H2,1H3/t22-/m1/s1 |
| InChIKey | HDWAKLHVTJIKKM-JOCHJYFZSA-N |
| XLogP | 5.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |