C23H17BrFNO2 — CID 94072981
(2R)-2-(4-bromophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-phenyl-2H-pyrrol-5-one (PubChem CID 94072981) has the molecular formula C23H17BrFNO2 and a molecular weight of 438.30 g/mol. Its IUPAC name is (2R)-2-(4-bromophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-phenyl-2H-pyrrol-5-one.
| Compound Name | (2R)-2-(4-bromophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94072981 |
| Molecular Formula | C23H17BrFNO2 |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | (2R)-2-(4-bromophenyl)-1-[(4-fluorophenyl)methyl]-4-hydroxy-3-phenyl-2H-pyrrol-5-one |
| SMILES | O=C1C(O)=C(c2ccccc2)[C@@H](c2ccc(Br)cc2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H17BrFNO2/c24-18-10-8-17(9-11-18)21-20(16-4-2-1-3-5-16)22(27)23(28)26(21)14-15-6-12-19(25)13-7-15/h1-13,21,27H,14H2/t21-/m1/s1 |
| InChIKey | JGQCGAAWNOWCNL-OAQYLSRUSA-N |
| XLogP | 5.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |