C23H18FNO2 — CID 45031889
1-benzyl-3-(4-fluorophenyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one (PubChem CID 45031889) has the molecular formula C23H18FNO2 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-benzyl-3-(4-fluorophenyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one.
| Compound Name | 1-benzyl-3-(4-fluorophenyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 45031889 |
| Molecular Formula | C23H18FNO2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-benzyl-3-(4-fluorophenyl)-4-hydroxy-2-phenyl-2H-pyrrol-5-one |
| SMILES | O=C1C(O)=C(c2ccc(F)cc2)C(c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H18FNO2/c24-19-13-11-17(12-14-19)20-21(18-9-5-2-6-10-18)25(23(27)22(20)26)15-16-7-3-1-4-8-16/h1-14,21,26H,15H2 |
| InChIKey | HJIWNLKTARJLST-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |