C26H25NO2 — CID 94072919
(2S)-2-(4-ethylphenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one (PubChem CID 94072919) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2S)-2-(4-ethylphenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one.
| Compound Name | (2S)-2-(4-ethylphenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94072919 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2S)-2-(4-ethylphenyl)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2H-pyrrol-5-one |
| SMILES | CCc1ccc([C@H]2C(c3ccccc3)=C(O)C(=O)N2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H25NO2/c1-3-19-13-15-22(16-14-19)24-23(21-7-5-4-6-8-21)25(28)26(29)27(24)17-20-11-9-18(2)10-12-20/h4-16,24,28H,3,17H2,1-2H3/t24-/m0/s1 |
| InChIKey | GKVVDHVIVRQHBR-DEOSSOPVSA-N |
| XLogP | 5.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |