C27H27NO2 — CID 51982033
(2R)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2-(4-propan-2-ylphenyl)-2H-pyrrol-5-one (PubChem CID 51982033) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2R)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2-(4-propan-2-ylphenyl)-2H-pyrrol-5-one.
| Compound Name | (2R)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2-(4-propan-2-ylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 51982033 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (2R)-4-hydroxy-1-[(4-methylphenyl)methyl]-3-phenyl-2-(4-propan-2-ylphenyl)-2H-pyrrol-5-one |
| SMILES | Cc1ccc(CN2C(=O)C(O)=C(c3ccccc3)[C@H]2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H27NO2/c1-18(2)21-13-15-23(16-14-21)25-24(22-7-5-4-6-8-22)26(29)27(30)28(25)17-20-11-9-19(3)10-12-20/h4-16,18,25,29H,17H2,1-3H3/t25-/m1/s1 |
| InChIKey | PIFRGXNKJDMAOT-RUZDIDTESA-N |
| XLogP | 6.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |