C25H22ClNO2 — CID 50773881
1-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)-4-hydroxy-3-phenyl-2H-pyrrol-5-one (PubChem CID 50773881) has the molecular formula C25H22ClNO2 and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)-4-hydroxy-3-phenyl-2H-pyrrol-5-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)-4-hydroxy-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 50773881 |
| Molecular Formula | C25H22ClNO2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-(4-ethylphenyl)-4-hydroxy-3-phenyl-2H-pyrrol-5-one |
| SMILES | CCc1ccc(C2C(c3ccccc3)=C(O)C(=O)N2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H22ClNO2/c1-2-17-8-12-20(13-9-17)23-22(19-6-4-3-5-7-19)24(28)25(29)27(23)16-18-10-14-21(26)15-11-18/h3-15,23,28H,2,16H2,1H3 |
| InChIKey | KKFRRKAAAXTJEM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |