C24H20ClNO3 — CID 94071913
(2S)-3-(4-chlorophenyl)-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2H-pyrrol-5-one (PubChem CID 94071913) has the molecular formula C24H20ClNO3 and a molecular weight of 405.88 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2H-pyrrol-5-one.
| Compound Name | (2S)-3-(4-chlorophenyl)-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94071913 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-4-hydroxy-1-[(4-methoxyphenyl)methyl]-2-phenyl-2H-pyrrol-5-one |
| SMILES | COc1ccc(CN2C(=O)C(O)=C(c3ccc(Cl)cc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20ClNO3/c1-29-20-13-7-16(8-14-20)15-26-22(18-5-3-2-4-6-18)21(23(27)24(26)28)17-9-11-19(25)12-10-17/h2-14,22,27H,15H2,1H3/t22-/m0/s1 |
| InChIKey | VSQQSFFGNUSPEA-QFIPXVFZSA-N |
| XLogP | 5.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |