C24H18FNO4 — CID 94073198
4-[(2R)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-5-oxo-2H-pyrrol-2-yl]benzoic acid (PubChem CID 94073198) has the molecular formula C24H18FNO4 and a molecular weight of 403.41 g/mol. Its IUPAC name is 4-[(2R)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-5-oxo-2H-pyrrol-2-yl]benzoic acid.
| Compound Name | 4-[(2R)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-5-oxo-2H-pyrrol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 94073198 |
| Molecular Formula | C24H18FNO4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-[(2R)-1-(4-fluorophenyl)-4-hydroxy-3-(4-methylphenyl)-5-oxo-2H-pyrrol-2-yl]benzoic acid |
| SMILES | Cc1ccc(C2=C(O)C(=O)N(c3ccc(F)cc3)[C@@H]2c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H18FNO4/c1-14-2-4-15(5-3-14)20-21(16-6-8-17(9-7-16)24(29)30)26(23(28)22(20)27)19-12-10-18(25)11-13-19/h2-13,21,27H,1H3,(H,29,30)/t21-/m1/s1 |
| InChIKey | SAKPQUJNIRLTDJ-OAQYLSRUSA-N |
| XLogP | 4.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |