C24H19F2NO3 — CID 94071830
(2R)-2-[4-(difluoromethoxy)phenyl]-4-hydroxy-1-(4-methylphenyl)-3-phenyl-2H-pyrrol-5-one (PubChem CID 94071830) has the molecular formula C24H19F2NO3 and a molecular weight of 407.42 g/mol. Its IUPAC name is (2R)-2-[4-(difluoromethoxy)phenyl]-4-hydroxy-1-(4-methylphenyl)-3-phenyl-2H-pyrrol-5-one.
| Compound Name | (2R)-2-[4-(difluoromethoxy)phenyl]-4-hydroxy-1-(4-methylphenyl)-3-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 94071830 |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2R)-2-[4-(difluoromethoxy)phenyl]-4-hydroxy-1-(4-methylphenyl)-3-phenyl-2H-pyrrol-5-one |
| SMILES | Cc1ccc(N2C(=O)C(O)=C(c3ccccc3)[C@H]2c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H19F2NO3/c1-15-7-11-18(12-8-15)27-21(17-9-13-19(14-10-17)30-24(25)26)20(22(28)23(27)29)16-5-3-2-4-6-16/h2-14,21,24,28H,1H3/t21-/m1/s1 |
| InChIKey | LXHLRXSQFWIZIS-OAQYLSRUSA-N |
| XLogP | 5.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |