C25H16Cl2FN3O4 — CID 108601867
(4E)-1-(1H-benzimidazol-2-yl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 108601867) has the molecular formula C25H16Cl2FN3O4 and a molecular weight of 512.32 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108601867 |
| Molecular Formula | C25H16Cl2FN3O4 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccccc4[nH]3)C2c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C25H16Cl2FN3O4/c1-35-23-15(26)10-13(11-16(23)27)21(32)19-20(12-6-8-14(28)9-7-12)31(24(34)22(19)33)25-29-17-4-2-3-5-18(17)30-25/h2-11,20,32H,1H3,(H,29,30)/b21-19+ |
| InChIKey | JNLLMFVHGZITJY-XUTLUUPISA-N |
| XLogP | 5.64 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|