C24H15Cl2N3O4 — CID 108583459
(4E)-1-(1H-benzimidazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108583459) has the molecular formula C24H15Cl2N3O4 and a molecular weight of 480.31 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108583459 |
| Molecular Formula | C24H15Cl2N3O4 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccccc3[nH]2)C(c2ccc(O)cc2)/C1=C(\O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H15Cl2N3O4/c25-15-10-7-13(11-16(15)26)21(31)19-20(12-5-8-14(30)9-6-12)29(23(33)22(19)32)24-27-17-3-1-2-4-18(17)28-24/h1-11,20,30-31H,(H,27,28)/b21-19+ |
| InChIKey | VPVOACUYHDNCSJ-XUTLUUPISA-N |
| XLogP | 5.20 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|