C26H18BrN3O6 — CID 108709694
2-[(3E)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108709694) has the molecular formula C26H18BrN3O6 and a molecular weight of 548.35 g/mol. Its IUPAC name is 2-[(3E)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108709694 |
| Molecular Formula | C26H18BrN3O6 |
| Molecular Weight | 548.35 g/mol |
| Exact Mass | 547.04 |
| IUPAC Name | 2-[(3E)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4[nH]3)C2c2ccc(O)cc2)ccc1Br |
| InChI | InChI=1S/C26H18BrN3O6/c1-12-10-14(4-8-17(12)27)22(32)20-21(13-2-6-16(31)7-3-13)30(24(34)23(20)33)26-28-18-9-5-15(25(35)36)11-19(18)29-26/h2-11,21,31-32H,1H3,(H,28,29)(H,35,36)/b22-20+ |
| InChIKey | QAMIMKDZAGTXNJ-LSDHQDQOSA-N |
| XLogP | 4.66 |
| TPSA | 143.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|