C27H21N3O8 — CID 108709749
2-[(3E)-3-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108709749) has the molecular formula C27H21N3O8 and a molecular weight of 515.48 g/mol. Its IUPAC name is 2-[(3E)-3-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108709749 |
| Molecular Formula | C27H21N3O8 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-[(3E)-3-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cccc(OC)c1/C(O)=C1\C(=O)C(=O)N(c2nc3ccc(C(=O)O)cc3[nH]2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C27H21N3O8/c1-37-18-4-3-5-19(38-2)20(18)23(32)21-22(13-6-9-15(31)10-7-13)30(25(34)24(21)33)27-28-16-11-8-14(26(35)36)12-17(16)29-27/h3-12,22,31-32H,1-2H3,(H,28,29)(H,35,36)/b23-21+ |
| InChIKey | HQCDFUIZBPEWRJ-XTQSDGFTSA-N |
| XLogP | 3.61 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|