C30H21N3O6 — CID 108700433
2-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108700433) has the molecular formula C30H21N3O6 and a molecular weight of 519.51 g/mol. Its IUPAC name is 2-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108700433 |
| Molecular Formula | C30H21N3O6 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 2-[(3E)-3-[hydroxy(naphthalen-1-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cccc(C2/C(=C(\O)c3cccc4ccccc34)C(=O)C(=O)N2c2nc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C30H21N3O6/c1-39-19-9-4-8-17(14-19)25-24(26(34)21-11-5-7-16-6-2-3-10-20(16)21)27(35)28(36)33(25)30-31-22-13-12-18(29(37)38)15-23(22)32-30/h2-15,25,34H,1H3,(H,31,32)(H,37,38)/b26-24+ |
| InChIKey | ZSBXVVQBVPXCJR-SHHOIMCASA-N |
| XLogP | 5.05 |
| TPSA | 132.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|