C32H31N3O7 — CID 108700394
2-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108700394) has the molecular formula C32H31N3O7 and a molecular weight of 569.61 g/mol. Its IUPAC name is 2-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108700394 |
| Molecular Formula | C32H31N3O7 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4[nH]3)C2c2cccc(OC)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C32H31N3O7/c1-6-42-24-13-11-18(15-21(24)32(2,3)4)27(36)25-26(17-8-7-9-20(14-17)41-5)35(29(38)28(25)37)31-33-22-12-10-19(30(39)40)16-23(22)34-31/h7-16,26,36H,6H2,1-5H3,(H,33,34)(H,39,40)/b27-25+ |
| InChIKey | VOXDXRNMPQPZNJ-IMVLJIQESA-N |
| XLogP | 5.59 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|