C27H20ClF2N3O5 — CID 108700237
(4E)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1H-benzimidazol-2-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108700237) has the molecular formula C27H20ClF2N3O5 and a molecular weight of 539.92 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1H-benzimidazol-2-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1H-benzimidazol-2-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108700237 |
| Molecular Formula | C27H20ClF2N3O5 |
| Molecular Weight | 539.92 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | (4E)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-(5,6-difluoro-1H-benzimidazol-2-yl)-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4cc(F)c(F)cc4[nH]3)C2c2cccc(OC)c2)ccc1Cl |
| InChI | InChI=1S/C27H20ClF2N3O5/c1-3-38-21-10-14(7-8-16(21)28)24(34)22-23(13-5-4-6-15(9-13)37-2)33(26(36)25(22)35)27-31-19-11-17(29)18(30)12-20(19)32-27/h4-12,23,34H,3H2,1-2H3,(H,31,32)/b24-22+ |
| InChIKey | CTVAKSKSIMRKGZ-ZNTNEXAZSA-N |
| XLogP | 5.53 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|