C27H21F2N3O4 — CID 108700249
(4E)-1-(5,6-difluoro-1H-benzimidazol-2-yl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108700249) has the molecular formula C27H21F2N3O4 and a molecular weight of 489.48 g/mol. Its IUPAC name is (4E)-1-(5,6-difluoro-1H-benzimidazol-2-yl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5,6-difluoro-1H-benzimidazol-2-yl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108700249 |
| Molecular Formula | C27H21F2N3O4 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (4E)-1-(5,6-difluoro-1H-benzimidazol-2-yl)-4-[(2,5-dimethylphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(\O)c3cc(C)ccc3C)C(=O)C(=O)N2c2nc3cc(F)c(F)cc3[nH]2)c1 |
| InChI | InChI=1S/C27H21F2N3O4/c1-13-7-8-14(2)17(9-13)24(33)22-23(15-5-4-6-16(10-15)36-3)32(26(35)25(22)34)27-30-20-11-18(28)19(29)12-21(20)31-27/h4-12,23,33H,1-3H3,(H,30,31)/b24-22+ |
| InChIKey | ZNAFAEFVSIUHAD-ZNTNEXAZSA-N |
| XLogP | 5.09 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|