C27H21N3O6 — CID 108700435
2-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108700435) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is 2-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108700435 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[(3E)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cccc(C2/C(=C(\O)c3ccc(C)cc3)C(=O)C(=O)N2c2nc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C27H21N3O6/c1-14-6-8-15(9-7-14)23(31)21-22(16-4-3-5-18(12-16)36-2)30(25(33)24(21)32)27-28-19-11-10-17(26(34)35)13-20(19)29-27/h3-13,22,31H,1-2H3,(H,28,29)(H,34,35)/b23-21+ |
| InChIKey | AYBUXVYQKSTLID-XTQSDGFTSA-N |
| XLogP | 4.20 |
| TPSA | 132.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|