C26H18N4O7 — CID 108715324
2-[(3E)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108715324) has the molecular formula C26H18N4O7 and a molecular weight of 498.45 g/mol. Its IUPAC name is 2-[(3E)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108715324 |
| Molecular Formula | C26H18N4O7 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[(3E)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | Cc1cccc(C2/C(=C(\O)c3cccc([N+](=O)[O-])c3)C(=O)C(=O)N2c2nc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C26H18N4O7/c1-13-4-2-5-14(10-13)21-20(22(31)15-6-3-7-17(11-15)30(36)37)23(32)24(33)29(21)26-27-18-9-8-16(25(34)35)12-19(18)28-26/h2-12,21,31H,1H3,(H,27,28)(H,34,35)/b22-20+ |
| InChIKey | VRSPHAIZXCBPHO-LSDHQDQOSA-N |
| XLogP | 4.10 |
| TPSA | 166.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|