C31H29N3O6 — CID 108715354
2-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108715354) has the molecular formula C31H29N3O6 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108715354 |
| Molecular Formula | C31H29N3O6 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | Cc1cccc(C2/C(=C(\O)c3ccc(OCC(C)C)c(C)c3)C(=O)C(=O)N2c2nc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C31H29N3O6/c1-16(2)15-40-24-11-9-20(13-18(24)4)27(35)25-26(19-7-5-6-17(3)12-19)34(29(37)28(25)36)31-32-22-10-8-21(30(38)39)14-23(22)33-31/h5-14,16,26,35H,15H2,1-4H3,(H,32,33)(H,38,39)/b27-25+ |
| InChIKey | FFQPNVPKPSJMSF-IMVLJIQESA-N |
| XLogP | 5.54 |
| TPSA | 132.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|