C33H34FN3O4 — CID 108720048
(4E)-5-(4-tert-butylphenyl)-1-(6-fluoro-1H-benzimidazol-2-yl)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 108720048) has the molecular formula C33H34FN3O4 and a molecular weight of 555.65 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-1-(6-fluoro-1H-benzimidazol-2-yl)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-1-(6-fluoro-1H-benzimidazol-2-yl)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108720048 |
| Molecular Formula | C33H34FN3O4 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-1-(6-fluoro-1H-benzimidazol-2-yl)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(F)cc4[nH]3)C2c2ccc(C(C)(C)C)cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C33H34FN3O4/c1-18(2)17-41-26-14-9-21(15-19(26)3)29(38)27-28(20-7-10-22(11-8-20)33(4,5)6)37(31(40)30(27)39)32-35-24-13-12-23(34)16-25(24)36-32/h7-16,18,28,38H,17H2,1-6H3,(H,35,36)/b29-27+ |
| InChIKey | IOQNYXVOLVBAAW-ORIPQNMZSA-N |
| XLogP | 6.97 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|