C31H30F3NO5 — CID 108699559
(4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108699559) has the molecular formula C31H30F3NO5 and a molecular weight of 553.58 g/mol. Its IUPAC name is (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108699559 |
| Molecular Formula | C31H30F3NO5 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | (4Z)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C(F)(F)F)cc3)C2c2cccc(OC)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C31H30F3NO5/c1-6-40-24-15-10-19(17-23(24)30(2,3)4)27(36)25-26(18-8-7-9-22(16-18)39-5)35(29(38)28(25)37)21-13-11-20(12-14-21)31(32,33)34/h7-17,26,36H,6H2,1-5H3/b27-25- |
| InChIKey | AOKPLGHSOLEMBK-RFBIWTDZSA-N |
| XLogP | 7.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|