C33H35NO6 — CID 108688115
[3-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108688115) has the molecular formula C33H35NO6 and a molecular weight of 541.64 g/mol. Its IUPAC name is [3-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688115 |
| Molecular Formula | C33H35NO6 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | [3-[(3E)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(4-ethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(CC)cc3)C2c2cccc(OC(C)=O)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C33H35NO6/c1-7-21-12-15-24(16-13-21)34-29(22-10-9-11-25(18-22)40-20(3)35)28(31(37)32(34)38)30(36)23-14-17-27(39-8-2)26(19-23)33(4,5)6/h9-19,29,36H,7-8H2,1-6H3/b30-28+ |
| InChIKey | LHWZPIXFNXULSJ-SJCQXOIGSA-N |
| XLogP | 6.50 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|