C27H20ClN3O8 — CID 108709709
2-[(3E)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid (PubChem CID 108709709) has the molecular formula C27H20ClN3O8 and a molecular weight of 549.92 g/mol. Its IUPAC name is 2-[(3E)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-[(3E)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 108709709 |
| Molecular Formula | C27H20ClN3O8 |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 2-[(3E)-3-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]-3H-benzimidazole-5-carboxylic acid |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4[nH]3)C2c2ccc(O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C27H20ClN3O8/c1-38-19-11-16(28)20(39-2)10-15(19)23(33)21-22(12-3-6-14(32)7-4-12)31(25(35)24(21)34)27-29-17-8-5-13(26(36)37)9-18(17)30-27/h3-11,22,32-33H,1-2H3,(H,29,30)(H,36,37)/b23-21+ |
| InChIKey | UPCHBZDSPROSMB-XTQSDGFTSA-N |
| XLogP | 4.26 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|