C18H26O5 — CID 10860244
prop-2-enyl (E)-10-(1,3-dioxan-2-yl)-3-hydroxy-4-methyldec-4-en-9-ynoate (PubChem CID 10860244) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is prop-2-enyl (E)-10-(1,3-dioxan-2-yl)-3-hydroxy-4-methyldec-4-en-9-ynoate.
| Compound Name | prop-2-enyl (E)-10-(1,3-dioxan-2-yl)-3-hydroxy-4-methyldec-4-en-9-ynoate |
|---|---|
| PubChem CID | 10860244 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | prop-2-enyl (E)-10-(1,3-dioxan-2-yl)-3-hydroxy-4-methyldec-4-en-9-ynoate |
| SMILES | C=CCOC(=O)CC(O)/C(C)=C/CCCC#CC1OCCCO1 |
| InChI | InChI=1S/C18H26O5/c1-3-11-21-17(20)14-16(19)15(2)9-6-4-5-7-10-18-22-12-8-13-23-18/h3,9,16,18-19H,1,4-6,8,11-14H2,2H3/b15-9+ |
| InChIKey | WJJXHZNYOPCHBL-OQLLNIDSSA-N |
| XLogP | 2.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|