C17H28O5 — CID 10925005
methyl 2-[(2R,6R)-2-[(E)-7-hydroxyhept-2-en-2-yl]-6-methoxy-3-methyl-2,5-dihydropyran-6-yl]acetate (PubChem CID 10925005) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 2-[(2R,6R)-2-[(E)-7-hydroxyhept-2-en-2-yl]-6-methoxy-3-methyl-2,5-dihydropyran-6-yl]acetate.
| Compound Name | methyl 2-[(2R,6R)-2-[(E)-7-hydroxyhept-2-en-2-yl]-6-methoxy-3-methyl-2,5-dihydropyran-6-yl]acetate |
|---|---|
| PubChem CID | 10925005 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl 2-[(2R,6R)-2-[(E)-7-hydroxyhept-2-en-2-yl]-6-methoxy-3-methyl-2,5-dihydropyran-6-yl]acetate |
| SMILES | COC(=O)C[C@@]1(OC)CC=C(C)[C@@H](/C(C)=C/CCCCO)O1 |
| InChI | InChI=1S/C17H28O5/c1-13(8-6-5-7-11-18)16-14(2)9-10-17(21-4,22-16)12-15(19)20-3/h8-9,16,18H,5-7,10-12H2,1-4H3/b13-8+/t16-,17-/m1/s1 |
| InChIKey | GTQIAAXKFYWEPL-UTTIPUOZSA-N |
| XLogP | 2.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|