C15H24O4 — CID 11011006
prop-2-enyl (4E,9E)-3,11-dihydroxy-4-methylundeca-4,9-dienoate (PubChem CID 11011006) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is prop-2-enyl (4E,9E)-3,11-dihydroxy-4-methylundeca-4,9-dienoate.
| Compound Name | prop-2-enyl (4E,9E)-3,11-dihydroxy-4-methylundeca-4,9-dienoate |
|---|---|
| PubChem CID | 11011006 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | prop-2-enyl (4E,9E)-3,11-dihydroxy-4-methylundeca-4,9-dienoate |
| SMILES | C=CCOC(=O)CC(O)/C(C)=C/CCC/C=C/CO |
| InChI | InChI=1S/C15H24O4/c1-3-11-19-15(18)12-14(17)13(2)9-7-5-4-6-8-10-16/h3,6,8-9,14,16-17H,1,4-5,7,10-12H2,2H3/b8-6+,13-9+ |
| InChIKey | AZBGKUVPOMVSDY-NRKDHPQSSA-N |
| XLogP | 2.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|