C17H24O4 — CID 151936738
6,6-bis(3-methylbut-2-enoxy)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 151936738) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 6,6-bis(3-methylbut-2-enoxy)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6,6-bis(3-methylbut-2-enoxy)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 151936738 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 6,6-bis(3-methylbut-2-enoxy)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC(C)=CCOC1(OCC=C(C)C)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C17H24O4/c1-13(2)8-11-20-17(21-12-9-14(3)4)10-6-5-7-15(17)16(18)19/h5-10,15H,11-12H2,1-4H3,(H,18,19) |
| InChIKey | SZYJFXQDQKSGHZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|