C27H40O4 — CID 151288727
6,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 151288727) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is 6,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 151288727 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 6,6-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC(C)=CCC/C(C)=C/COC1(OC/C=C(\C)CCC=C(C)C)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C27H40O4/c1-21(2)11-9-13-23(5)16-19-30-27(18-8-7-15-25(27)26(28)29)31-20-17-24(6)14-10-12-22(3)4/h7-8,11-12,15-18,25H,9-10,13-14,19-20H2,1-6H3,(H,28,29)/b23-16+,24-17+ |
| InChIKey | NZYWTDVZGSYHGK-WPHIWBHXSA-N |
| XLogP | 6.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|