C18H24O6 — CID 67898708
2-[(4-butoxy-4-methoxy-3-prop-2-enylcyclohexa-1,5-dien-1-yl)methylidene]propanedioic acid (PubChem CID 67898708) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[(4-butoxy-4-methoxy-3-prop-2-enylcyclohexa-1,5-dien-1-yl)methylidene]propanedioic acid.
| Compound Name | 2-[(4-butoxy-4-methoxy-3-prop-2-enylcyclohexa-1,5-dien-1-yl)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 67898708 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[(4-butoxy-4-methoxy-3-prop-2-enylcyclohexa-1,5-dien-1-yl)methylidene]propanedioic acid |
| SMILES | C=CCC1C=C(C=C(C(=O)O)C(=O)O)C=CC1(OC)OCCCC |
| InChI | InChI=1S/C18H24O6/c1-4-6-10-24-18(23-3)9-8-13(11-14(18)7-5-2)12-15(16(19)20)17(21)22/h5,8-9,11-12,14H,2,4,6-7,10H2,1,3H3,(H,19,20)(H,21,22) |
| InChIKey | MVUFBIAOVFLQIJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|