C26H20FNO5 — CID 108602606
(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108602606) has the molecular formula C26H20FNO5 and a molecular weight of 445.45 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108602606 |
| Molecular Formula | C26H20FNO5 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-(3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)CCO4)C2c2ccccc2F)c1 |
| InChI | InChI=1S/C26H20FNO5/c1-32-18-6-4-5-17(14-18)28-23(19-7-2-3-8-20(19)27)22(25(30)26(28)31)24(29)16-9-10-21-15(13-16)11-12-33-21/h2-10,13-14,23,29H,11-12H2,1H3/b24-22+ |
| InChIKey | XXXGESWYLLFNDC-ZNTNEXAZSA-N |
| XLogP | 4.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|