C26H17F4NO4 — CID 108680718
(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108680718) has the molecular formula C26H17F4NO4 and a molecular weight of 483.42 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680718 |
| Molecular Formula | C26H17F4NO4 |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(C(F)(F)F)c2)C(c2ccccc2F)/C1=C(\O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C26H17F4NO4/c27-19-7-2-1-6-18(19)22-21(23(32)15-8-9-20-14(12-15)10-11-35-20)24(33)25(34)31(22)17-5-3-4-16(13-17)26(28,29)30/h1-9,12-13,22,32H,10-11H2/b23-21+ |
| InChIKey | HFBIEUBJWQQIBO-XTQSDGFTSA-N |
| XLogP | 5.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|