C28H23F3N2O4 — CID 108706340
(4Z)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-[4-(dimethylamino)phenyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108706340) has the molecular formula C28H23F3N2O4 and a molecular weight of 508.50 g/mol. Its IUPAC name is (4Z)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-[4-(dimethylamino)phenyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-[4-(dimethylamino)phenyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108706340 |
| Molecular Formula | C28H23F3N2O4 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (4Z)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-5-[4-(dimethylamino)phenyl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | CN(C)c1ccc(C2/C(=C(/O)c3ccc4c(c3)CCO4)C(=O)C(=O)N2c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H23F3N2O4/c1-32(2)20-9-6-16(7-10-20)24-23(25(34)18-8-11-22-17(14-18)12-13-37-22)26(35)27(36)33(24)21-5-3-4-19(15-21)28(29,30)31/h3-11,14-15,24,34H,12-13H2,1-2H3/b25-23- |
| InChIKey | UBQMDVDRQULKCB-BZZOAKBMSA-N |
| XLogP | 5.33 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|