C24H13Cl2F4NO3 — CID 108680693
(4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108680693) has the molecular formula C24H13Cl2F4NO3 and a molecular weight of 510.27 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108680693 |
| Molecular Formula | C24H13Cl2F4NO3 |
| Molecular Weight | 510.27 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(2-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(C(F)(F)F)c2)C(c2ccccc2F)/C1=C(\O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H13Cl2F4NO3/c25-16-9-8-12(10-17(16)26)21(32)19-20(15-6-1-2-7-18(15)27)31(23(34)22(19)33)14-5-3-4-13(11-14)24(28,29)30/h1-11,20,32H/b21-19+ |
| InChIKey | PTCQHKSLFIVFTF-XUTLUUPISA-N |
| XLogP | 6.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.27 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|