C25H16Cl2F3NO4 — CID 108699430
(4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108699430) has the molecular formula C25H16Cl2F3NO4 and a molecular weight of 522.31 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108699430 |
| Molecular Formula | C25H16Cl2F3NO4 |
| Molecular Weight | 522.31 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-methoxyphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(\O)c3ccc(Cl)c(Cl)c3)C(=O)C(=O)N2c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H16Cl2F3NO4/c1-35-17-7-2-4-13(10-17)21-20(22(32)14-8-9-18(26)19(27)11-14)23(33)24(34)31(21)16-6-3-5-15(12-16)25(28,29)30/h2-12,21,32H,1H3/b22-20+ |
| InChIKey | IGRVSEPHAOFTDM-LSDHQDQOSA-N |
| XLogP | 6.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.31 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|