C23H16N2O4S — CID 108603727
4-hydroxy-1-(2-hydroxyphenyl)-2-(1H-indol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one (PubChem CID 108603727) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-hydroxy-1-(2-hydroxyphenyl)-2-(1H-indol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(2-hydroxyphenyl)-2-(1H-indol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108603727 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-hydroxy-1-(2-hydroxyphenyl)-2-(1H-indol-3-yl)-3-(thiophene-2-carbonyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(c2ccccc2O)C1c1c[nH]c2ccccc12)c1cccs1 |
| InChI | InChI=1S/C23H16N2O4S/c26-17-9-4-3-8-16(17)25-20(14-12-24-15-7-2-1-6-13(14)15)19(22(28)23(25)29)21(27)18-10-5-11-30-18/h1-12,20,24,26,28H |
| InChIKey | XWHXXUFSMMAQEG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |